C21H13N5O5 — CID 136961453
5'-nitro-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-1H-indole]-2',10-dione (PubChem CID 136961453) has the molecular formula C21H13N5O5 and a molecular weight of 415.37 g/mol. Its IUPAC name is 5'-nitro-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-1H-indole]-2',10-dione.
| Compound Name | 5'-nitro-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-1H-indole]-2',10-dione |
|---|---|
| PubChem CID | 136961453 |
| Molecular Formula | C21H13N5O5 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 5'-nitro-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-1H-indole]-2',10-dione |
| SMILES | O=C1OCC2=C1C1(C(=O)Nc3ccc([N+](=O)[O-])cc31)c1c(n[nH]c1-c1ccccc1)N2 |
| InChI | InChI=1S/C21H13N5O5/c27-19-15-14(9-31-19)22-18-16(17(24-25-18)10-4-2-1-3-5-10)21(15)12-8-11(26(29)30)6-7-13(12)23-20(21)28/h1-8H,9H2,(H,23,28)(H2,22,24,25) |
| InChIKey | RGMCERWDTLEBMB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 139.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|