C21H16N4O5 — CID 137228805
8-(4-methoxy-3-nitrophenyl)-6-phenyl-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-10-one (PubChem CID 137228805) has the molecular formula C21H16N4O5 and a molecular weight of 404.38 g/mol. Its IUPAC name is 8-(4-methoxy-3-nitrophenyl)-6-phenyl-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-10-one.
| Compound Name | 8-(4-methoxy-3-nitrophenyl)-6-phenyl-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-10-one |
|---|---|
| PubChem CID | 137228805 |
| Molecular Formula | C21H16N4O5 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 8-(4-methoxy-3-nitrophenyl)-6-phenyl-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-10-one |
| SMILES | COc1ccc(C2C3=C(COC3=O)Nc3n[nH]c(-c4ccccc4)c32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N4O5/c1-29-15-8-7-12(9-14(15)25(27)28)16-17-13(10-30-21(17)26)22-20-18(16)19(23-24-20)11-5-3-2-4-6-11/h2-9,16H,10H2,1H3,(H2,22,23,24) |
| InChIKey | AMXYWGRCRSCPLB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|