C16H14N4O5 — CID 135524242
12-amino-8-(4-hydroxy-3-methoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),12-triene-6,10-dione (PubChem CID 135524242) has the molecular formula C16H14N4O5 and a molecular weight of 342.31 g/mol. Its IUPAC name is 12-amino-8-(4-hydroxy-3-methoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),12-triene-6,10-dione.
| Compound Name | 12-amino-8-(4-hydroxy-3-methoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),12-triene-6,10-dione |
|---|---|
| PubChem CID | 135524242 |
| Molecular Formula | C16H14N4O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 12-amino-8-(4-hydroxy-3-methoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),12-triene-6,10-dione |
| SMILES | COc1cc(C2C3=C(COC3=O)Nc3nc(N)[nH]c(=O)c32)ccc1O |
| InChI | InChI=1S/C16H14N4O5/c1-24-9-4-6(2-3-8(9)21)10-11-7(5-25-15(11)23)18-13-12(10)14(22)20-16(17)19-13/h2-4,10,21H,5H2,1H3,(H4,17,18,19,20,22) |
| InChIKey | WJJZRTQVSWHRFG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |