C21H14N4O4 — CID 10596290
4-(3-nitrophenyl)-3-phenylspiro[1,2,4-oxadiazole-5,3'-1H-indole]-2'-one (PubChem CID 10596290) has the molecular formula C21H14N4O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-3-phenylspiro[1,2,4-oxadiazole-5,3'-1H-indole]-2'-one.
| Compound Name | 4-(3-nitrophenyl)-3-phenylspiro[1,2,4-oxadiazole-5,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 10596290 |
| Molecular Formula | C21H14N4O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 4-(3-nitrophenyl)-3-phenylspiro[1,2,4-oxadiazole-5,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2ccccc2C12ON=C(c1ccccc1)N2c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H14N4O4/c26-20-21(17-11-4-5-12-18(17)22-20)24(15-9-6-10-16(13-15)25(27)28)19(23-29-21)14-7-2-1-3-8-14/h1-13H,(H,22,26) |
| InChIKey | FCFYRXPQVXLFHZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|