C21H22N2O3 — CID 22019375
1',1'-dimethyl-5-(3-nitrophenyl)spiro[1H-indole-3,4'-cyclohexane]-2-one (PubChem CID 22019375) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1',1'-dimethyl-5-(3-nitrophenyl)spiro[1H-indole-3,4'-cyclohexane]-2-one.
| Compound Name | 1',1'-dimethyl-5-(3-nitrophenyl)spiro[1H-indole-3,4'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 22019375 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1',1'-dimethyl-5-(3-nitrophenyl)spiro[1H-indole-3,4'-cyclohexane]-2-one |
| SMILES | CC1(C)CCC2(CC1)C(=O)Nc1ccc(-c3cccc([N+](=O)[O-])c3)cc12 |
| InChI | InChI=1S/C21H22N2O3/c1-20(2)8-10-21(11-9-20)17-13-15(6-7-18(17)22-19(21)24)14-4-3-5-16(12-14)23(25)26/h3-7,12-13H,8-11H2,1-2H3,(H,22,24) |
| InChIKey | KOODKFQGVPVHFP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|