C19H20N2O — CID 138045616
5-(6-methyl-3-pyridinyl)spiro[1H-indole-3,1'-cyclohexane]-2-one (PubChem CID 138045616) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-(6-methyl-3-pyridinyl)spiro[1H-indole-3,1'-cyclohexane]-2-one.
| Compound Name | 5-(6-methyl-3-pyridinyl)spiro[1H-indole-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 138045616 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 5-(6-methyl-3-pyridinyl)spiro[1H-indole-3,1'-cyclohexane]-2-one |
| SMILES | Cc1ccc(-c2ccc3c(c2)C2(CCCCC2)C(=O)N3)cn1 |
| InChI | InChI=1S/C19H20N2O/c1-13-5-6-15(12-20-13)14-7-8-17-16(11-14)19(18(22)21-17)9-3-2-4-10-19/h5-8,11-12H,2-4,9-10H2,1H3,(H,21,22) |
| InChIKey | VIABYQJRWUSXSP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |