C14H15NO2 — CID 156760180
5-methylspiro[1H-indole-3,4'-cyclohexane]-1',2-dione (PubChem CID 156760180) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 5-methylspiro[1H-indole-3,4'-cyclohexane]-1',2-dione.
| Compound Name | 5-methylspiro[1H-indole-3,4'-cyclohexane]-1',2-dione |
|---|---|
| PubChem CID | 156760180 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 5-methylspiro[1H-indole-3,4'-cyclohexane]-1',2-dione |
| SMILES | Cc1ccc2c(c1)C1(CCC(=O)CC1)C(=O)N2 |
| InChI | InChI=1S/C14H15NO2/c1-9-2-3-12-11(8-9)14(13(17)15-12)6-4-10(16)5-7-14/h2-3,8H,4-7H2,1H3,(H,15,17) |
| InChIKey | NBWXMTIPXBTCEG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |