C11H9Cl2NO — CID 175639660
(3S)-1',1'-dichloro-5-methylspiro[1H-indole-3,2'-cyclopropane]-2-one (PubChem CID 175639660) has the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. Its IUPAC name is (3S)-1',1'-dichloro-5-methylspiro[1H-indole-3,2'-cyclopropane]-2-one.
| Compound Name | (3S)-1',1'-dichloro-5-methylspiro[1H-indole-3,2'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 175639660 |
| Molecular Formula | C11H9Cl2NO |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | (3S)-1',1'-dichloro-5-methylspiro[1H-indole-3,2'-cyclopropane]-2-one |
| SMILES | Cc1ccc2c(c1)[C@@]1(CC1(Cl)Cl)C(=O)N2 |
| InChI | InChI=1S/C11H9Cl2NO/c1-6-2-3-8-7(4-6)10(9(15)14-8)5-11(10,12)13/h2-4H,5H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | ZLVLBGNQLFDEAB-JTQLQIEISA-N |
| XLogP | 2.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|