C14H17NO3 — CID 91448943
5,5,5'-trimethylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one (PubChem CID 91448943) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 5,5,5'-trimethylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
| Compound Name | 5,5,5'-trimethylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 91448943 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 5,5,5'-trimethylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| SMILES | Cc1ccc2c(c1)C1(OCC(C)(C)CO1)C(=O)N2 |
| InChI | InChI=1S/C14H17NO3/c1-9-4-5-11-10(6-9)14(12(16)15-11)17-7-13(2,3)8-18-14/h4-6H,7-8H2,1-3H3,(H,15,16) |
| InChIKey | ADWBMQSMDDPKQH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |