C13H19NO2 — CID 143767422
ethane;2,2,7-trimethyl-4H-1,4-benzoxazin-3-one (PubChem CID 143767422) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is ethane;2,2,7-trimethyl-4H-1,4-benzoxazin-3-one.
| Compound Name | ethane;2,2,7-trimethyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 143767422 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | ethane;2,2,7-trimethyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC.Cc1ccc2c(c1)OC(C)(C)C(=O)N2 |
| InChI | InChI=1S/C11H13NO2.C2H6/c1-7-4-5-8-9(6-7)14-11(2,3)10(13)12-8;1-2/h4-6H,1-3H3,(H,12,13);1-2H3 |
| InChIKey | LNGXOTMLQCTCNC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |