C16H16N2O2 — CID 116995080
7-(3-aminophenyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one (PubChem CID 116995080) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 7-(3-aminophenyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(3-aminophenyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116995080 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 7-(3-aminophenyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2cc(-c3cccc(N)c3)ccc2NC1=O |
| InChI | InChI=1S/C16H16N2O2/c1-16(2)15(19)18-13-7-6-11(9-14(13)20-16)10-4-3-5-12(17)8-10/h3-9H,17H2,1-2H3,(H,18,19) |
| InChIKey | ZAIJFXGYDJHQHC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|