C14H17NO2 — CID 115098131
7-methylspiro[4H-1,4-benzoxazine-2,1'-cyclohexane]-3-one (PubChem CID 115098131) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 7-methylspiro[4H-1,4-benzoxazine-2,1'-cyclohexane]-3-one.
| Compound Name | 7-methylspiro[4H-1,4-benzoxazine-2,1'-cyclohexane]-3-one |
|---|---|
| PubChem CID | 115098131 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 7-methylspiro[4H-1,4-benzoxazine-2,1'-cyclohexane]-3-one |
| SMILES | Cc1ccc2c(c1)OC1(CCCCC1)C(=O)N2 |
| InChI | InChI=1S/C14H17NO2/c1-10-5-6-11-12(9-10)17-14(13(16)15-11)7-3-2-4-8-14/h5-6,9H,2-4,7-8H2,1H3,(H,15,16) |
| InChIKey | QYBRIYYWWCEIDJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |