C19H27NO — CID 15438270
3-methyl-7,8,9,10,11,12,13,14,15,16-decahydro-6H-cyclododeca[b][1,4]benzoxazine (PubChem CID 15438270) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 3-methyl-7,8,9,10,11,12,13,14,15,16-decahydro-6H-cyclododeca[b][1,4]benzoxazine.
| Compound Name | 3-methyl-7,8,9,10,11,12,13,14,15,16-decahydro-6H-cyclododeca[b][1,4]benzoxazine |
|---|---|
| PubChem CID | 15438270 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 3-methyl-7,8,9,10,11,12,13,14,15,16-decahydro-6H-cyclododeca[b][1,4]benzoxazine |
| SMILES | Cc1ccc2c(c1)OC1=C(CCCCCCCCCC1)N2 |
| InChI | InChI=1S/C19H27NO/c1-15-12-13-17-19(14-15)21-18-11-9-7-5-3-2-4-6-8-10-16(18)20-17/h12-14,20H,2-11H2,1H3 |
| InChIKey | RHVUUWIGDBUJPY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |