C19H16N2O — CID 151544815
3,7-dimethyl-1-pyridin-2-yl-10H-phenoxazine (PubChem CID 151544815) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is 3,7-dimethyl-1-pyridin-2-yl-10H-phenoxazine.
| Compound Name | 3,7-dimethyl-1-pyridin-2-yl-10H-phenoxazine |
|---|---|
| PubChem CID | 151544815 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 3,7-dimethyl-1-pyridin-2-yl-10H-phenoxazine |
| SMILES | Cc1ccc2c(c1)Oc1cc(C)cc(-c3ccccn3)c1N2 |
| InChI | InChI=1S/C19H16N2O/c1-12-6-7-16-17(10-12)22-18-11-13(2)9-14(19(18)21-16)15-5-3-4-8-20-15/h3-11,21H,1-2H3 |
| InChIKey | PZFOGRLKHHFNDZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |