C18H20ClNO4 — CID 145273654
3-chloro-7-methyl-10H-phenoxazine;oxane-3,4-diol (PubChem CID 145273654) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is 3-chloro-7-methyl-10H-phenoxazine;oxane-3,4-diol.
| Compound Name | 3-chloro-7-methyl-10H-phenoxazine;oxane-3,4-diol |
|---|---|
| PubChem CID | 145273654 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-chloro-7-methyl-10H-phenoxazine;oxane-3,4-diol |
| SMILES | Cc1ccc2c(c1)Oc1cc(Cl)ccc1N2.OC1CCOCC1O |
| InChI | InChI=1S/C13H10ClNO.C5H10O3/c1-8-2-4-10-12(6-8)16-13-7-9(14)3-5-11(13)15-10;6-4-1-2-8-3-5(4)7/h2-7,15H,1H3;4-7H,1-3H2 |
| InChIKey | NGUPSLFMUJSPKU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |