C15H17ClN2O2 — CID 91777937
(3R,4R)-3-[(7-chloro-4-methylquinolin-2-yl)amino]oxan-4-ol (PubChem CID 91777937) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is (3R,4R)-3-[(7-chloro-4-methylquinolin-2-yl)amino]oxan-4-ol.
| Compound Name | (3R,4R)-3-[(7-chloro-4-methylquinolin-2-yl)amino]oxan-4-ol |
|---|---|
| PubChem CID | 91777937 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (3R,4R)-3-[(7-chloro-4-methylquinolin-2-yl)amino]oxan-4-ol |
| SMILES | Cc1cc(N[C@@H]2COCC[C@H]2O)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H17ClN2O2/c1-9-6-15(18-13-8-20-5-4-14(13)19)17-12-7-10(16)2-3-11(9)12/h2-3,6-7,13-14,19H,4-5,8H2,1H3,(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | KFHAZPCBPLEUSX-ZIAGYGMSSA-N |
| XLogP | 2.76 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |