C15H16Cl2N2 — CID 162413926
4,7-dichloro-N-cyclohexylquinolin-2-amine (PubChem CID 162413926) has the molecular formula C15H16Cl2N2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 4,7-dichloro-N-cyclohexylquinolin-2-amine.
| Compound Name | 4,7-dichloro-N-cyclohexylquinolin-2-amine |
|---|---|
| PubChem CID | 162413926 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4,7-dichloro-N-cyclohexylquinolin-2-amine |
| SMILES | Clc1ccc2c(Cl)cc(NC3CCCCC3)nc2c1 |
| InChI | InChI=1S/C15H16Cl2N2/c16-10-6-7-12-13(17)9-15(19-14(12)8-10)18-11-4-2-1-3-5-11/h6-9,11H,1-5H2,(H,18,19) |
| InChIKey | BSKUTXWYVLMEFU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |