C21H30ClN3O — CID 144970640
4-chloro-N-cyclohexylquinolin-2-amine;N,2,2-trimethylpropanamide (PubChem CID 144970640) has the molecular formula C21H30ClN3O and a molecular weight of 375.94 g/mol. Its IUPAC name is 4-chloro-N-cyclohexylquinolin-2-amine;N,2,2-trimethylpropanamide.
| Compound Name | 4-chloro-N-cyclohexylquinolin-2-amine;N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 144970640 |
| Molecular Formula | C21H30ClN3O |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 4-chloro-N-cyclohexylquinolin-2-amine;N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)C.Clc1cc(NC2CCCCC2)nc2ccccc12 |
| InChI | InChI=1S/C15H17ClN2.C6H13NO/c16-13-10-15(17-11-6-2-1-3-7-11)18-14-9-5-4-8-12(13)14;1-6(2,3)5(8)7-4/h4-5,8-11H,1-3,6-7H2,(H,17,18);1-4H3,(H,7,8) |
| InChIKey | PSVMXEZSZDZZMQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |