C17H19ClN2O2 — CID 141107459
ethyl 4-chloro-2-(cyclopentylamino)quinoline-3-carboxylate (PubChem CID 141107459) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is ethyl 4-chloro-2-(cyclopentylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 4-chloro-2-(cyclopentylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 141107459 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | ethyl 4-chloro-2-(cyclopentylamino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC2CCCC2)nc2ccccc2c1Cl |
| InChI | InChI=1S/C17H19ClN2O2/c1-2-22-17(21)14-15(18)12-9-5-6-10-13(12)20-16(14)19-11-7-3-4-8-11/h5-6,9-11H,2-4,7-8H2,1H3,(H,19,20) |
| InChIKey | SSEGUQCPNPIBNL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |