C15H17N3O2 — CID 64624194
ethyl 4-(cyclobutylamino)cinnoline-3-carboxylate (PubChem CID 64624194) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is ethyl 4-(cyclobutylamino)cinnoline-3-carboxylate.
| Compound Name | ethyl 4-(cyclobutylamino)cinnoline-3-carboxylate |
|---|---|
| PubChem CID | 64624194 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | ethyl 4-(cyclobutylamino)cinnoline-3-carboxylate |
| SMILES | CCOC(=O)c1nnc2ccccc2c1NC1CCC1 |
| InChI | InChI=1S/C15H17N3O2/c1-2-20-15(19)14-13(16-10-6-5-7-10)11-8-3-4-9-12(11)17-18-14/h3-4,8-10H,2,5-7H2,1H3,(H,16,17) |
| InChIKey | BXDXKUXCVOVDAY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |