C13H12F3N3O2 — CID 64624179
ethyl 4-(2,2,2-trifluoroethylamino)cinnoline-3-carboxylate (PubChem CID 64624179) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is ethyl 4-(2,2,2-trifluoroethylamino)cinnoline-3-carboxylate.
| Compound Name | ethyl 4-(2,2,2-trifluoroethylamino)cinnoline-3-carboxylate |
|---|---|
| PubChem CID | 64624179 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | ethyl 4-(2,2,2-trifluoroethylamino)cinnoline-3-carboxylate |
| SMILES | CCOC(=O)c1nnc2ccccc2c1NCC(F)(F)F |
| InChI | InChI=1S/C13H12F3N3O2/c1-2-21-12(20)11-10(17-7-13(14,15)16)8-5-3-4-6-9(8)18-19-11/h3-6H,2,7H2,1H3,(H,17,18) |
| InChIKey | IGDKYXDIBXQKDV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |