C14H17N3O4 — CID 65313889
ethyl 4-(1,3-dihydroxypropan-2-ylamino)cinnoline-3-carboxylate (PubChem CID 65313889) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is ethyl 4-(1,3-dihydroxypropan-2-ylamino)cinnoline-3-carboxylate.
| Compound Name | ethyl 4-(1,3-dihydroxypropan-2-ylamino)cinnoline-3-carboxylate |
|---|---|
| PubChem CID | 65313889 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | ethyl 4-(1,3-dihydroxypropan-2-ylamino)cinnoline-3-carboxylate |
| SMILES | CCOC(=O)c1nnc2ccccc2c1NC(CO)CO |
| InChI | InChI=1S/C14H17N3O4/c1-2-21-14(20)13-12(15-9(7-18)8-19)10-5-3-4-6-11(10)16-17-13/h3-6,9,18-19H,2,7-8H2,1H3,(H,15,16) |
| InChIKey | ANWXTYIYQPNUOW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |