About ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate
ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate (PubChem CID 133406275) has the molecular formula C17H18N4O2S
and a molecular weight of 342.42 g/mol. Its IUPAC name is ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate |
| PubChem CID | 133406275 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate |
| SMILES | CCOC(=O)c1nnc2ccccc2c1NCc1nc(C)sc1C |
| InChI | InChI=1S/C17H18N4O2S/c1-4-23-17(22)16-15(12-7-5-6-8-13(12)20-21-16)18-9-14-10(2)24-11(3)19-14/h5-8H,4,9H2,1-3H3,(H,18,20) |
| InChIKey | QSEVECIOIJZHED-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate?
The IUPAC name of ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate (CID 133406275) is ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate.
What is the SMILES notation for ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate?
The canonical SMILES for ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate is CCOC(=O)c1nnc2ccccc2c1NCc1nc(C)sc1C.
What is the InChIKey of ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate?
The InChIKey is QSEVECIOIJZHED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O2S/c1-4-23-17(22)16-15(12-7-5-6-8-13(12)20-21-16)18-9-14-10(2)24-11(3)19-14/h5-8H,4,9H2,1-3H3,(H,18,20).
What are the key properties of ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate?
ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate has a molecular weight of 342.42 g/mol, XLogP of 3.49, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]cinnoline-3-carboxylate is sourced from PubChem (CID 133406275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).