C20H23N3O2S — CID 15514651
ethyl 3-amino-4-(cyclohexylamino)thieno[2,3-b]quinoline-2-carboxylate (PubChem CID 15514651) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is ethyl 3-amino-4-(cyclohexylamino)thieno[2,3-b]quinoline-2-carboxylate.
| Compound Name | ethyl 3-amino-4-(cyclohexylamino)thieno[2,3-b]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 15514651 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | ethyl 3-amino-4-(cyclohexylamino)thieno[2,3-b]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1sc2nc3ccccc3c(NC3CCCCC3)c2c1N |
| InChI | InChI=1S/C20H23N3O2S/c1-2-25-20(24)18-16(21)15-17(22-12-8-4-3-5-9-12)13-10-6-7-11-14(13)23-19(15)26-18/h6-7,10-12H,2-5,8-9,21H2,1H3,(H,22,23) |
| InChIKey | UEQOITUGWATJRR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |