C20H20N4O2S — CID 101103173
ethyl 15-cyclohexyl-10-thia-8,13,14,15-tetrazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11,13-heptaene-11-carboxylate (PubChem CID 101103173) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is ethyl 15-cyclohexyl-10-thia-8,13,14,15-tetrazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11,13-heptaene-11-carboxylate.
| Compound Name | ethyl 15-cyclohexyl-10-thia-8,13,14,15-tetrazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11,13-heptaene-11-carboxylate |
|---|---|
| PubChem CID | 101103173 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | ethyl 15-cyclohexyl-10-thia-8,13,14,15-tetrazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11,13-heptaene-11-carboxylate |
| SMILES | CCOC(=O)c1sc2nc3ccccc3c3c2c1N=NN3C1CCCCC1 |
| InChI | InChI=1S/C20H20N4O2S/c1-2-26-20(25)18-16-15-17(24(23-22-16)12-8-4-3-5-9-12)13-10-6-7-11-14(13)21-19(15)27-18/h6-7,10-12H,2-5,8-9H2,1H3 |
| InChIKey | LEQBQAKTOZHSHZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |