C18H21N3O2S — CID 11163711
ethyl 3-amino-4-(butylamino)thieno[3,2-c]quinoline-2-carboxylate (PubChem CID 11163711) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is ethyl 3-amino-4-(butylamino)thieno[3,2-c]quinoline-2-carboxylate.
| Compound Name | ethyl 3-amino-4-(butylamino)thieno[3,2-c]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 11163711 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | ethyl 3-amino-4-(butylamino)thieno[3,2-c]quinoline-2-carboxylate |
| SMILES | CCCCNc1nc2ccccc2c2sc(C(=O)OCC)c(N)c12 |
| InChI | InChI=1S/C18H21N3O2S/c1-3-5-10-20-17-13-14(19)16(18(22)23-4-2)24-15(13)11-8-6-7-9-12(11)21-17/h6-9H,3-5,10,19H2,1-2H3,(H,20,21) |
| InChIKey | IGTYWGINKWMBIU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|