C26H24Cl2N4S2 — CID 11577315
N,N'-bis(thieno[3,2-c]quinolin-4-yl)butane-1,4-diamine;dihydrochloride (PubChem CID 11577315) has the molecular formula C26H24Cl2N4S2 and a molecular weight of 527.55 g/mol. Its IUPAC name is N,N'-bis(thieno[3,2-c]quinolin-4-yl)butane-1,4-diamine;dihydrochloride.
| Compound Name | N,N'-bis(thieno[3,2-c]quinolin-4-yl)butane-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 11577315 |
| Molecular Formula | C26H24Cl2N4S2 |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | N,N'-bis(thieno[3,2-c]quinolin-4-yl)butane-1,4-diamine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2c(c1)nc(NCCCCNc1nc3ccccc3c3sccc13)c1ccsc12 |
| InChI | InChI=1S/C26H22N4S2.2ClH/c1-3-9-21-17(7-1)23-19(11-15-31-23)25(29-21)27-13-5-6-14-28-26-20-12-16-32-24(20)18-8-2-4-10-22(18)30-26;;/h1-4,7-12,15-16H,5-6,13-14H2,(H,27,29)(H,28,30);2*1H |
| InChIKey | PPKAKJQDHNBASP-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|