C14H15N5OS — CID 143858026
N'-amino-4-(2-hydroxyethylamino)thieno[3,2-c]quinoline-7-carboximidamide (PubChem CID 143858026) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is N'-amino-4-(2-hydroxyethylamino)thieno[3,2-c]quinoline-7-carboximidamide.
| Compound Name | N'-amino-4-(2-hydroxyethylamino)thieno[3,2-c]quinoline-7-carboximidamide |
|---|---|
| PubChem CID | 143858026 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N'-amino-4-(2-hydroxyethylamino)thieno[3,2-c]quinoline-7-carboximidamide |
| SMILES | N/N=C(\N)c1ccc2c(c1)nc(NCCO)c1ccsc12 |
| InChI | InChI=1S/C14H15N5OS/c15-13(19-16)8-1-2-9-11(7-8)18-14(17-4-5-20)10-3-6-21-12(9)10/h1-3,6-7,20H,4-5,16H2,(H2,15,19)(H,17,18) |
| InChIKey | OMQCGSUIEDPXKQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|