C19H16FN5OS — CID 143638374
N'-amino-4-(4-fluoro-3-methoxyanilino)thieno[3,2-c]quinoline-7-carboximidamide (PubChem CID 143638374) has the molecular formula C19H16FN5OS and a molecular weight of 381.44 g/mol. Its IUPAC name is N'-amino-4-(4-fluoro-3-methoxyanilino)thieno[3,2-c]quinoline-7-carboximidamide.
| Compound Name | N'-amino-4-(4-fluoro-3-methoxyanilino)thieno[3,2-c]quinoline-7-carboximidamide |
|---|---|
| PubChem CID | 143638374 |
| Molecular Formula | C19H16FN5OS |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N'-amino-4-(4-fluoro-3-methoxyanilino)thieno[3,2-c]quinoline-7-carboximidamide |
| SMILES | COc1cc(Nc2nc3cc(/C(N)=N/N)ccc3c3sccc23)ccc1F |
| InChI | InChI=1S/C19H16FN5OS/c1-26-16-9-11(3-5-14(16)20)23-19-13-6-7-27-17(13)12-4-2-10(18(21)25-22)8-15(12)24-19/h2-9H,22H2,1H3,(H2,21,25)(H,23,24) |
| InChIKey | NYRGZDFYAVOWDF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|