C19H14ClFN6 — CID 143638479
N'-amino-5-(4-chloro-3-fluoroanilino)benzo[c][2,6]naphthyridine-8-carboximidamide (PubChem CID 143638479) has the molecular formula C19H14ClFN6 and a molecular weight of 380.81 g/mol. Its IUPAC name is N'-amino-5-(4-chloro-3-fluoroanilino)benzo[c][2,6]naphthyridine-8-carboximidamide.
| Compound Name | N'-amino-5-(4-chloro-3-fluoroanilino)benzo[c][2,6]naphthyridine-8-carboximidamide |
|---|---|
| PubChem CID | 143638479 |
| Molecular Formula | C19H14ClFN6 |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N'-amino-5-(4-chloro-3-fluoroanilino)benzo[c][2,6]naphthyridine-8-carboximidamide |
| SMILES | N/N=C(\N)c1ccc2c(c1)nc(Nc1ccc(Cl)c(F)c1)c1ccncc12 |
| InChI | InChI=1S/C19H14ClFN6/c20-15-4-2-11(8-16(15)21)25-19-13-5-6-24-9-14(13)12-3-1-10(18(22)27-23)7-17(12)26-19/h1-9H,23H2,(H2,22,27)(H,25,26) |
| InChIKey | GIYPVSYGTMXCBG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|