C19H13N3O3 — CID 136602231
5-(4-hydroxyanilino)benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 136602231) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 5-(4-hydroxyanilino)benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-(4-hydroxyanilino)benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 136602231 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 5-(4-hydroxyanilino)benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(Nc1ccc(O)cc1)c1ccncc12 |
| InChI | InChI=1S/C19H13N3O3/c23-13-4-2-12(3-5-13)21-18-15-7-8-20-10-16(15)14-6-1-11(19(24)25)9-17(14)22-18/h1-10,23H,(H,21,22)(H,24,25) |
| InChIKey | URLVYGUZDZMMTH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|