C19H13ClFN7 — CID 137124950
5-(4-chloro-3-fluoroanilino)-N'-diazenylbenzo[c][2,6]naphthyridine-8-carboximidamide (PubChem CID 137124950) has the molecular formula C19H13ClFN7 and a molecular weight of 393.81 g/mol. Its IUPAC name is 5-(4-chloro-3-fluoroanilino)-N'-diazenylbenzo[c][2,6]naphthyridine-8-carboximidamide.
| Compound Name | 5-(4-chloro-3-fluoroanilino)-N'-diazenylbenzo[c][2,6]naphthyridine-8-carboximidamide |
|---|---|
| PubChem CID | 137124950 |
| Molecular Formula | C19H13ClFN7 |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 5-(4-chloro-3-fluoroanilino)-N'-diazenylbenzo[c][2,6]naphthyridine-8-carboximidamide |
| SMILES | [H]/N=N/N=C(N)c1ccc2c(c1)nc(Nc1ccc(Cl)c(F)c1)c1ccncc12 |
| InChI | InChI=1S/C19H13ClFN7/c20-15-4-2-11(8-16(15)21)25-19-13-5-6-24-9-14(13)12-3-1-10(7-17(12)26-19)18(22)27-28-23/h1-9H,(H,25,26)(H3,22,23,27) |
| InChIKey | SZOYAFAECIIOEU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|