C20H15ClN6 — CID 143858117
5-(3-chloroanilino)-N'-methanimidoylbenzo[c][2,6]naphthyridine-7-carboximidamide (PubChem CID 143858117) has the molecular formula C20H15ClN6 and a molecular weight of 374.84 g/mol. Its IUPAC name is 5-(3-chloroanilino)-N'-methanimidoylbenzo[c][2,6]naphthyridine-7-carboximidamide.
| Compound Name | 5-(3-chloroanilino)-N'-methanimidoylbenzo[c][2,6]naphthyridine-7-carboximidamide |
|---|---|
| PubChem CID | 143858117 |
| Molecular Formula | C20H15ClN6 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 5-(3-chloroanilino)-N'-methanimidoylbenzo[c][2,6]naphthyridine-7-carboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1cccc2c1nc(Nc1cccc(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C20H15ClN6/c21-12-3-1-4-13(9-12)26-20-15-7-8-24-10-17(15)14-5-2-6-16(18(14)27-20)19(23)25-11-22/h1-11H,(H,26,27)(H3,22,23,25) |
| InChIKey | LVEJHLNUAPRHMT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|