C22H19ClN4 — CID 89148355
N-(3-chlorophenyl)-7-[1-(dimethylamino)ethenyl]benzo[c][2,6]naphthyridin-5-amine (PubChem CID 89148355) has the molecular formula C22H19ClN4 and a molecular weight of 374.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)-7-[1-(dimethylamino)ethenyl]benzo[c][2,6]naphthyridin-5-amine.
| Compound Name | N-(3-chlorophenyl)-7-[1-(dimethylamino)ethenyl]benzo[c][2,6]naphthyridin-5-amine |
|---|---|
| PubChem CID | 89148355 |
| Molecular Formula | C22H19ClN4 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-(3-chlorophenyl)-7-[1-(dimethylamino)ethenyl]benzo[c][2,6]naphthyridin-5-amine |
| SMILES | C=C(c1cccc2c1nc(Nc1cccc(Cl)c1)c1ccncc12)N(C)C |
| InChI | InChI=1S/C22H19ClN4/c1-14(27(2)3)17-8-5-9-18-20-13-24-11-10-19(20)22(26-21(17)18)25-16-7-4-6-15(23)12-16/h4-13H,1H2,2-3H3,(H,25,26) |
| InChIKey | AAHPVAVKMDYISM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|