C24H22N8O2S — CID 136635962
3-[[7-(N'-diazenylcarbamimidoyl)thieno[3,2-c]quinolin-4-yl]amino]-N-(2-imino-4-oxopentyl)benzamide (PubChem CID 136635962) has the molecular formula C24H22N8O2S and a molecular weight of 486.56 g/mol. Its IUPAC name is 3-[[7-(N'-diazenylcarbamimidoyl)thieno[3,2-c]quinolin-4-yl]amino]-N-(2-imino-4-oxopentyl)benzamide.
| Compound Name | 3-[[7-(N'-diazenylcarbamimidoyl)thieno[3,2-c]quinolin-4-yl]amino]-N-(2-imino-4-oxopentyl)benzamide |
|---|---|
| PubChem CID | 136635962 |
| Molecular Formula | C24H22N8O2S |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 3-[[7-(N'-diazenylcarbamimidoyl)thieno[3,2-c]quinolin-4-yl]amino]-N-(2-imino-4-oxopentyl)benzamide |
| SMILES | [H]/N=N/N=C(N)c1ccc2c(c1)nc(Nc1cccc(C(=O)NC/C(CC(C)=O)=N/[H])c1)c1ccsc12 |
| InChI | InChI=1S/C24H22N8O2S/c1-13(33)9-16(25)12-28-24(34)15-3-2-4-17(10-15)29-23-19-7-8-35-21(19)18-6-5-14(11-20(18)30-23)22(26)31-32-27/h2-8,10-11,25H,9,12H2,1H3,(H,28,34)(H,29,30)(H3,26,27,31)/b25-16+ |
| InChIKey | GXLHQOYDGIRGIT-PCLIKHOPSA-N |
| XLogP | 4.57 |
| TPSA | 169.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|