C19H15N5OS — CID 143638398
N'-amino-4-(3-formylanilino)thieno[3,2-c]quinoline-7-carboximidamide (PubChem CID 143638398) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is N'-amino-4-(3-formylanilino)thieno[3,2-c]quinoline-7-carboximidamide.
| Compound Name | N'-amino-4-(3-formylanilino)thieno[3,2-c]quinoline-7-carboximidamide |
|---|---|
| PubChem CID | 143638398 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N'-amino-4-(3-formylanilino)thieno[3,2-c]quinoline-7-carboximidamide |
| SMILES | N/N=C(\N)c1ccc2c(c1)nc(Nc1cccc(C=O)c1)c1ccsc12 |
| InChI | InChI=1S/C19H15N5OS/c20-18(24-21)12-4-5-14-16(9-12)23-19(15-6-7-26-17(14)15)22-13-3-1-2-11(8-13)10-25/h1-10H,21H2,(H2,20,24)(H,22,23) |
| InChIKey | LQAFNBYDOPVPSO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|