C20H19N5OS — CID 143638450
N'-amino-4-(3-ethoxyanilino)thieno[3,2-c]quinoline-7-carboximidamide (PubChem CID 143638450) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is N'-amino-4-(3-ethoxyanilino)thieno[3,2-c]quinoline-7-carboximidamide.
| Compound Name | N'-amino-4-(3-ethoxyanilino)thieno[3,2-c]quinoline-7-carboximidamide |
|---|---|
| PubChem CID | 143638450 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N'-amino-4-(3-ethoxyanilino)thieno[3,2-c]quinoline-7-carboximidamide |
| SMILES | CCOc1cccc(Nc2nc3cc(/C(N)=N/N)ccc3c3sccc23)c1 |
| InChI | InChI=1S/C20H19N5OS/c1-2-26-14-5-3-4-13(11-14)23-20-16-8-9-27-18(16)15-7-6-12(19(21)25-22)10-17(15)24-20/h3-11H,2,22H2,1H3,(H2,21,25)(H,23,24) |
| InChIKey | DEVVHPAWGURPAJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|