C18H15FN6S — CID 143638501
N,N'-diamino-4-(4-fluoroanilino)thieno[3,2-c]quinoline-7-carboximidamide (PubChem CID 143638501) has the molecular formula C18H15FN6S and a molecular weight of 366.43 g/mol. Its IUPAC name is N,N'-diamino-4-(4-fluoroanilino)thieno[3,2-c]quinoline-7-carboximidamide.
| Compound Name | N,N'-diamino-4-(4-fluoroanilino)thieno[3,2-c]quinoline-7-carboximidamide |
|---|---|
| PubChem CID | 143638501 |
| Molecular Formula | C18H15FN6S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N,N'-diamino-4-(4-fluoroanilino)thieno[3,2-c]quinoline-7-carboximidamide |
| SMILES | N/N=C(\NN)c1ccc2c(c1)nc(Nc1ccc(F)cc1)c1ccsc12 |
| InChI | InChI=1S/C18H15FN6S/c19-11-2-4-12(5-3-11)22-18-14-7-8-26-16(14)13-6-1-10(9-15(13)23-18)17(24-20)25-21/h1-9H,20-21H2,(H,22,23)(H,24,25) |
| InChIKey | KIGKHDCRKXDLBD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|