C20H20N7OS+ — CID 143638436
3-[[7-[(Z)-N-aminocarbamohydrazonoyl]thieno[3,2-c]quinolin-5-ium-4-yl]amino]-N-methylbenzamide (PubChem CID 143638436) has the molecular formula C20H20N7OS+ and a molecular weight of 406.50 g/mol. Its IUPAC name is 3-[[7-[(Z)-N-aminocarbamohydrazonoyl]thieno[3,2-c]quinolin-5-ium-4-yl]amino]-N-methylbenzamide.
| Compound Name | 3-[[7-[(Z)-N-aminocarbamohydrazonoyl]thieno[3,2-c]quinolin-5-ium-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 143638436 |
| Molecular Formula | C20H20N7OS+ |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 3-[[7-[(Z)-N-aminocarbamohydrazonoyl]thieno[3,2-c]quinolin-5-ium-4-yl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(Nc2[nH+]c3cc(/C(=N/N)NN)ccc3c3sccc23)c1 |
| InChI | InChI=1S/C20H19N7OS/c1-23-20(28)12-3-2-4-13(9-12)24-19-15-7-8-29-17(15)14-6-5-11(10-16(14)25-19)18(26-21)27-22/h2-10H,21-22H2,1H3,(H,23,28)(H,24,25)(H,26,27)/p+1 |
| InChIKey | NUHIILWXXOWSTR-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|