C16H20N4S — CID 89148329
4-N-[3-(dimethylamino)propyl]thieno[3,2-c]quinoline-4,7-diamine (PubChem CID 89148329) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)propyl]thieno[3,2-c]quinoline-4,7-diamine.
| Compound Name | 4-N-[3-(dimethylamino)propyl]thieno[3,2-c]quinoline-4,7-diamine |
|---|---|
| PubChem CID | 89148329 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-N-[3-(dimethylamino)propyl]thieno[3,2-c]quinoline-4,7-diamine |
| SMILES | CN(C)CCCNc1nc2cc(N)ccc2c2sccc12 |
| InChI | InChI=1S/C16H20N4S/c1-20(2)8-3-7-18-16-13-6-9-21-15(13)12-5-4-11(17)10-14(12)19-16/h4-6,9-10H,3,7-8,17H2,1-2H3,(H,18,19) |
| InChIKey | SEWVGOPDHIUAFB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|