C15H16N4S — CID 89151012
4-(3-aminopyrrolidin-1-yl)thieno[3,2-c]quinolin-7-amine (PubChem CID 89151012) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is 4-(3-aminopyrrolidin-1-yl)thieno[3,2-c]quinolin-7-amine.
| Compound Name | 4-(3-aminopyrrolidin-1-yl)thieno[3,2-c]quinolin-7-amine |
|---|---|
| PubChem CID | 89151012 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-(3-aminopyrrolidin-1-yl)thieno[3,2-c]quinolin-7-amine |
| SMILES | Nc1ccc2c(c1)nc(N1CCC(N)C1)c1ccsc12 |
| InChI | InChI=1S/C15H16N4S/c16-9-1-2-11-13(7-9)18-15(12-4-6-20-14(11)12)19-5-3-10(17)8-19/h1-2,4,6-7,10H,3,5,8,16-17H2 |
| InChIKey | JZRCNOZNOWOWLE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|