C14H12N2O3S — CID 11369716
ethyl 3-amino-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylate (PubChem CID 11369716) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is ethyl 3-amino-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylate.
| Compound Name | ethyl 3-amino-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 11369716 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | ethyl 3-amino-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(c1N)c(=O)[nH]c1ccccc12 |
| InChI | InChI=1S/C14H12N2O3S/c1-2-19-14(18)12-10(15)9-11(20-12)7-5-3-4-6-8(7)16-13(9)17/h3-6H,2,15H2,1H3,(H,16,17) |
| InChIKey | HMJUGQQHVXVHHS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |