C20H26N2O3S — CID 133338071
ethyl 4-[(3-ethylsulfinylcyclohexyl)amino]quinoline-3-carboxylate (PubChem CID 133338071) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is ethyl 4-[(3-ethylsulfinylcyclohexyl)amino]quinoline-3-carboxylate.
| Compound Name | ethyl 4-[(3-ethylsulfinylcyclohexyl)amino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 133338071 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | ethyl 4-[(3-ethylsulfinylcyclohexyl)amino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccccc2c1NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C20H26N2O3S/c1-3-25-20(23)17-13-21-18-11-6-5-10-16(18)19(17)22-14-8-7-9-15(12-14)26(24)4-2/h5-6,10-11,13-15H,3-4,7-9,12H2,1-2H3,(H,21,22) |
| InChIKey | XUXKVILOZNGNNZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |