C26H27ClN2O2 — CID 53359332
ethyl 4-(4-chlorophenyl)-2-(cyclohexylamino)-6-phenylpyridine-3-carboxylate (PubChem CID 53359332) has the molecular formula C26H27ClN2O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-(cyclohexylamino)-6-phenylpyridine-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-(cyclohexylamino)-6-phenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 53359332 |
| Molecular Formula | C26H27ClN2O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-(cyclohexylamino)-6-phenylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)cc(-c2ccccc2)nc1NC1CCCCC1 |
| InChI | InChI=1S/C26H27ClN2O2/c1-2-31-26(30)24-22(18-13-15-20(27)16-14-18)17-23(19-9-5-3-6-10-19)29-25(24)28-21-11-7-4-8-12-21/h3,5-6,9-10,13-17,21H,2,4,7-8,11-12H2,1H3,(H,28,29) |
| InChIKey | LEQLLRONCYEJPE-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |