C11H12ClNO2 — CID 115825530
8-chloro-1,3,4,4a,10,10a-hexahydropyrano[4,3-b][1,4]benzoxazine (PubChem CID 115825530) has the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. Its IUPAC name is 8-chloro-1,3,4,4a,10,10a-hexahydropyrano[4,3-b][1,4]benzoxazine.
| Compound Name | 8-chloro-1,3,4,4a,10,10a-hexahydropyrano[4,3-b][1,4]benzoxazine |
|---|---|
| PubChem CID | 115825530 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 8-chloro-1,3,4,4a,10,10a-hexahydropyrano[4,3-b][1,4]benzoxazine |
| SMILES | Clc1ccc2c(c1)NC1COCCC1O2 |
| InChI | InChI=1S/C11H12ClNO2/c12-7-1-2-10-8(5-7)13-9-6-14-4-3-11(9)15-10/h1-2,5,9,11,13H,3-4,6H2 |
| InChIKey | LDAAXOYJCSIOSR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |