C12H16ClN3O — CID 143288801
5-chloro-N-piperidin-4-yl-2,3-dihydro-1,3-benzoxazol-2-amine (PubChem CID 143288801) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 5-chloro-N-piperidin-4-yl-2,3-dihydro-1,3-benzoxazol-2-amine.
| Compound Name | 5-chloro-N-piperidin-4-yl-2,3-dihydro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 143288801 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-chloro-N-piperidin-4-yl-2,3-dihydro-1,3-benzoxazol-2-amine |
| SMILES | Clc1ccc2c(c1)NC(NC1CCNCC1)O2 |
| InChI | InChI=1S/C12H16ClN3O/c13-8-1-2-11-10(7-8)16-12(17-11)15-9-3-5-14-6-4-9/h1-2,7,9,12,14-16H,3-6H2 |
| InChIKey | DYQRIYXMQSDKAI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |