C14H12ClNO2 — CID 6929817
(2S)-5-chloro-2-(4-methoxyphenyl)-2,3-dihydro-1,3-benzoxazole (PubChem CID 6929817) has the molecular formula C14H12ClNO2 and a molecular weight of 261.71 g/mol. Its IUPAC name is (2S)-5-chloro-2-(4-methoxyphenyl)-2,3-dihydro-1,3-benzoxazole.
| Compound Name | (2S)-5-chloro-2-(4-methoxyphenyl)-2,3-dihydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 6929817 |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (2S)-5-chloro-2-(4-methoxyphenyl)-2,3-dihydro-1,3-benzoxazole |
| SMILES | COc1ccc([C@H]2Nc3cc(Cl)ccc3O2)cc1 |
| InChI | InChI=1S/C14H12ClNO2/c1-17-11-5-2-9(3-6-11)14-16-12-8-10(15)4-7-13(12)18-14/h2-8,14,16H,1H3/t14-/m0/s1 |
| InChIKey | LNTHSPHYJRJFTG-AWEZNQCLSA-N |
| XLogP | 3.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |