C19H19NO3 — CID 71505602
(1S,3aR,9aS)-1-(4-methoxyphenyl)-7-methyl-3,3a,9,9a-tetrahydro-1H-cyclopenta[b][1,4]benzoxazin-2-one (PubChem CID 71505602) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (1S,3aR,9aS)-1-(4-methoxyphenyl)-7-methyl-3,3a,9,9a-tetrahydro-1H-cyclopenta[b][1,4]benzoxazin-2-one.
| Compound Name | (1S,3aR,9aS)-1-(4-methoxyphenyl)-7-methyl-3,3a,9,9a-tetrahydro-1H-cyclopenta[b][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 71505602 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (1S,3aR,9aS)-1-(4-methoxyphenyl)-7-methyl-3,3a,9,9a-tetrahydro-1H-cyclopenta[b][1,4]benzoxazin-2-one |
| SMILES | COc1ccc([C@@H]2C(=O)C[C@H]3Oc4ccc(C)cc4N[C@H]32)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-11-3-8-16-14(9-11)20-19-17(23-16)10-15(21)18(19)12-4-6-13(22-2)7-5-12/h3-9,17-20H,10H2,1-2H3/t17-,18-,19-/m1/s1 |
| InChIKey | RCGPIPOZZOAQNS-GUDVDZBRSA-N |
| XLogP | 3.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |