C14H18ClNO — CID 114287020
7-chloro-2-ethyl-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine (PubChem CID 114287020) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 7-chloro-2-ethyl-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine.
| Compound Name | 7-chloro-2-ethyl-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine |
|---|---|
| PubChem CID | 114287020 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 7-chloro-2-ethyl-2,3,4,4a,10,10a-hexahydro-1H-phenoxazine |
| SMILES | CCC1CCC2Oc3cc(Cl)ccc3NC2C1 |
| InChI | InChI=1S/C14H18ClNO/c1-2-9-3-6-13-12(7-9)16-11-5-4-10(15)8-14(11)17-13/h4-5,8-9,12-13,16H,2-3,6-7H2,1H3 |
| InChIKey | AJCGIKZSEJEEAM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |