C11H16ClNO — CID 156641344
7-chloro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine;ethane (PubChem CID 156641344) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 7-chloro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine;ethane.
| Compound Name | 7-chloro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine;ethane |
|---|---|
| PubChem CID | 156641344 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 7-chloro-2-methyl-3,4-dihydro-2H-1,4-benzoxazine;ethane |
| SMILES | CC.CC1CNc2ccc(Cl)cc2O1 |
| InChI | InChI=1S/C9H10ClNO.C2H6/c1-6-5-11-8-3-2-7(10)4-9(8)12-6;1-2/h2-4,6,11H,5H2,1H3;1-2H3 |
| InChIKey | HPAQOHUDKOIPOP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |